C30H35Cl2N5O3 — CID 44529329
(E)-3-(3,4-dichlorophenyl)-N-[5-[4-[(3-methyl-5-phenyl-1,2-oxazol-4-yl)carbamoylamino]piperidin-1-yl]pentyl]prop-2-enamide (PubChem CID 44529329) has the molecular formula C30H35Cl2N5O3 and a molecular weight of 584.55 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[(3-methyl-5-phenyl-1,2-oxazol-4-yl)carbamoylamino]piperidin-1-yl]pentyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[(3-methyl-5-phenyl-1,2-oxazol-4-yl)carbamoylamino]piperidin-1-yl]pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 44529329 |
| Molecular Formula | C30H35Cl2N5O3 |
| Molecular Weight | 584.55 g/mol |
| Exact Mass | 583.21 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[(3-methyl-5-phenyl-1,2-oxazol-4-yl)carbamoylamino]piperidin-1-yl]pentyl]prop-2-enamide |
| SMILES | Cc1noc(-c2ccccc2)c1NC(=O)NC1CCN(CCCCCNC(=O)/C=C/c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C30H35Cl2N5O3/c1-21-28(29(40-36-21)23-8-4-2-5-9-23)35-30(39)34-24-14-18-37(19-15-24)17-7-3-6-16-33-27(38)13-11-22-10-12-25(31)26(32)20-22/h2,4-5,8-13,20,24H,3,6-7,14-19H2,1H3,(H,33,38)(H2,34,35,39)/b13-11+ |
| InChIKey | OHELTGNTWXQUJV-ACCUITESSA-N |
| XLogP | 6.54 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.55 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|