C25H29Cl4N3O3S — CID 44529344
(E)-3-(3,4-dichlorophenyl)-N-[5-[4-[(3,5-dichlorophenyl)sulfonylamino]piperidin-1-yl]pentyl]prop-2-enamide (PubChem CID 44529344) has the molecular formula C25H29Cl4N3O3S and a molecular weight of 593.40 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[(3,5-dichlorophenyl)sulfonylamino]piperidin-1-yl]pentyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[(3,5-dichlorophenyl)sulfonylamino]piperidin-1-yl]pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 44529344 |
| Molecular Formula | C25H29Cl4N3O3S |
| Molecular Weight | 593.40 g/mol |
| Exact Mass | 591.07 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[(3,5-dichlorophenyl)sulfonylamino]piperidin-1-yl]pentyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCCCCN1CCC(NS(=O)(=O)c2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C25H29Cl4N3O3S/c26-19-15-20(27)17-22(16-19)36(34,35)31-21-8-12-32(13-9-21)11-3-1-2-10-30-25(33)7-5-18-4-6-23(28)24(29)14-18/h4-7,14-17,21,31H,1-3,8-13H2,(H,30,33)/b7-5+ |
| InChIKey | MIPHERPUAFQKEK-FNORWQNLSA-N |
| XLogP | 6.04 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.40 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|