C28H29F3N2O4 — CID 44529585
N-(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-6-methoxynaphthalene-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 44529585) has the molecular formula C28H29F3N2O4 and a molecular weight of 514.54 g/mol. Its IUPAC name is N-(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-6-methoxynaphthalene-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-6-methoxynaphthalene-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44529585 |
| Molecular Formula | C28H29F3N2O4 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | N-(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-6-methoxynaphthalene-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc2cc(C(=O)Nc3ccc4c(c3)CCN(C3CCC3)CC4)ccc2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H28N2O2.C2HF3O2/c1-30-25-10-8-19-15-22(6-5-20(19)17-25)26(29)27-23-9-7-18-11-13-28(24-3-2-4-24)14-12-21(18)16-23;3-2(4,5)1(6)7/h5-10,15-17,24H,2-4,11-14H2,1H3,(H,27,29);(H,6,7) |
| InChIKey | SXRBZKBYFMGZPH-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |