C29H27F6N9O5 — CID 44529690
1-[3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-7-(3-aminopropoxy)-1-ethylimidazo[4,5-c]pyridin-4-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea;2,2,2-trifluoroacetic acid (PubChem CID 44529690) has the molecular formula C29H27F6N9O5 and a molecular weight of 695.58 g/mol. Its IUPAC name is 1-[3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-7-(3-aminopropoxy)-1-ethylimidazo[4,5-c]pyridin-4-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-7-(3-aminopropoxy)-1-ethylimidazo[4,5-c]pyridin-4-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44529690 |
| Molecular Formula | C29H27F6N9O5 |
| Molecular Weight | 695.58 g/mol |
| Exact Mass | 695.20 |
| IUPAC Name | 1-[3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-7-(3-aminopropoxy)-1-ethylimidazo[4,5-c]pyridin-4-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea;2,2,2-trifluoroacetic acid |
| SMILES | CCn1c(-c2nonc2N)nc2c(-c3cccc(NC(=O)Nc4cccc(C(F)(F)F)c4)c3)ncc(OCCCN)c21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H26F3N9O3.C2HF3O2/c1-2-39-23-19(41-11-5-10-31)14-33-20(21(23)36-25(39)22-24(32)38-42-37-22)15-6-3-8-17(12-15)34-26(40)35-18-9-4-7-16(13-18)27(28,29)30;3-2(4,5)1(6)7/h3-4,6-9,12-14H,2,5,10-11,31H2,1H3,(H2,32,38)(H2,34,35,40);(H,6,7) |
| InChIKey | PRBCDLOWIVVYIJ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 209.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.58 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|