About 3-amino-5-[5-[3-(methanesulfonamido)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid
3-amino-5-[5-[3-(methanesulfonamido)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid (PubChem CID 44529747) has the molecular formula C21H18N4O4S
and a molecular weight of 422.47 g/mol. Its IUPAC name is 3-amino-5-[5-[3-(methanesulfonamido)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid.
Molecular Properties
| Compound Name | 3-amino-5-[5-[3-(methanesulfonamido)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid |
| PubChem CID | 44529747 |
| Molecular Formula | C21H18N4O4S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 3-amino-5-[5-[3-(methanesulfonamido)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid |
| SMILES | CS(=O)(=O)Nc1cccc(-c2cnc3[nH]cc(-c4cc(N)cc(C(=O)O)c4)c3c2)c1 |
| InChI | InChI=1S/C21H18N4O4S/c1-30(28,29)25-17-4-2-3-12(8-17)15-9-18-19(11-24-20(18)23-10-15)13-5-14(21(26)27)7-16(22)6-13/h2-11,25H,22H2,1H3,(H,23,24)(H,26,27) |
| InChIKey | FOTGXDBXVZWJOX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 138.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-5-[5-[3-(methanesulfonamido)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-[5-[3-(methanesulfonamido)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid?
The IUPAC name of 3-amino-5-[5-[3-(methanesulfonamido)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid (CID 44529747) is 3-amino-5-[5-[3-(methanesulfonamido)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid.
What is the SMILES notation for 3-amino-5-[5-[3-(methanesulfonamido)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid?
The canonical SMILES for 3-amino-5-[5-[3-(methanesulfonamido)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid is CS(=O)(=O)Nc1cccc(-c2cnc3[nH]cc(-c4cc(N)cc(C(=O)O)c4)c3c2)c1.
What is the InChIKey of 3-amino-5-[5-[3-(methanesulfonamido)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid?
The InChIKey is FOTGXDBXVZWJOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N4O4S/c1-30(28,29)25-17-4-2-3-12(8-17)15-9-18-19(11-24-20(18)23-10-15)13-5-14(21(26)27)7-16(22)6-13/h2-11,25H,22H2,1H3,(H,23,24)(H,26,27).
What are the key properties of 3-amino-5-[5-[3-(methanesulfonamido)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid?
3-amino-5-[5-[3-(methanesulfonamido)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid has a molecular weight of 422.47 g/mol, XLogP of 3.55, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-[5-[3-(methanesulfonamido)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid is sourced from PubChem (CID 44529747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).