C24H21N7O2S — CID 44529831
N-[4-[[4-(1H-indazol-4-ylamino)pyrimidin-2-yl]amino]phenyl]-4-methylbenzenesulfonamide (PubChem CID 44529831) has the molecular formula C24H21N7O2S and a molecular weight of 471.55 g/mol. Its IUPAC name is N-[4-[[4-(1H-indazol-4-ylamino)pyrimidin-2-yl]amino]phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[4-[[4-(1H-indazol-4-ylamino)pyrimidin-2-yl]amino]phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 44529831 |
| Molecular Formula | C24H21N7O2S |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | N-[4-[[4-(1H-indazol-4-ylamino)pyrimidin-2-yl]amino]phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(Nc3nccc(Nc4cccc5[nH]ncc45)n3)cc2)cc1 |
| InChI | InChI=1S/C24H21N7O2S/c1-16-5-11-19(12-6-16)34(32,33)31-18-9-7-17(8-10-18)27-24-25-14-13-23(29-24)28-21-3-2-4-22-20(21)15-26-30-22/h2-15,31H,1H3,(H,26,30)(H2,25,27,28,29) |
| InChIKey | VKWKQDJJTVXAGZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |