About [4-[(2,2-diphenylmorpholin-4-yl)methyl]piperidin-1-yl]-(4-methoxyphenyl)methanone
[4-[(2,2-diphenylmorpholin-4-yl)methyl]piperidin-1-yl]-(4-methoxyphenyl)methanone (PubChem CID 44529914) has the molecular formula C30H34N2O3
and a molecular weight of 470.61 g/mol. Its IUPAC name is [4-[(2,2-diphenylmorpholin-4-yl)methyl]piperidin-1-yl]-(4-methoxyphenyl)methanone.
Molecular Properties
| Compound Name | [4-[(2,2-diphenylmorpholin-4-yl)methyl]piperidin-1-yl]-(4-methoxyphenyl)methanone |
| PubChem CID | 44529914 |
| Molecular Formula | C30H34N2O3 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | [4-[(2,2-diphenylmorpholin-4-yl)methyl]piperidin-1-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCC(CN3CCOC(c4ccccc4)(c4ccccc4)C3)CC2)cc1 |
| InChI | InChI=1S/C30H34N2O3/c1-34-28-14-12-25(13-15-28)29(33)32-18-16-24(17-19-32)22-31-20-21-35-30(23-31,26-8-4-2-5-9-26)27-10-6-3-7-11-27/h2-15,24H,16-23H2,1H3 |
| InChIKey | AGBXVUVXNSCLPY-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[(2,2-diphenylmorpholin-4-yl)methyl]piperidin-1-yl]-(4-methoxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2,2-diphenylmorpholin-4-yl)methyl]piperidin-1-yl]-(4-methoxyphenyl)methanone?
The IUPAC name of [4-[(2,2-diphenylmorpholin-4-yl)methyl]piperidin-1-yl]-(4-methoxyphenyl)methanone (CID 44529914) is [4-[(2,2-diphenylmorpholin-4-yl)methyl]piperidin-1-yl]-(4-methoxyphenyl)methanone.
What is the SMILES notation for [4-[(2,2-diphenylmorpholin-4-yl)methyl]piperidin-1-yl]-(4-methoxyphenyl)methanone?
The canonical SMILES for [4-[(2,2-diphenylmorpholin-4-yl)methyl]piperidin-1-yl]-(4-methoxyphenyl)methanone is COc1ccc(C(=O)N2CCC(CN3CCOC(c4ccccc4)(c4ccccc4)C3)CC2)cc1.
What is the InChIKey of [4-[(2,2-diphenylmorpholin-4-yl)methyl]piperidin-1-yl]-(4-methoxyphenyl)methanone?
The InChIKey is AGBXVUVXNSCLPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H34N2O3/c1-34-28-14-12-25(13-15-28)29(33)32-18-16-24(17-19-32)22-31-20-21-35-30(23-31,26-8-4-2-5-9-26)27-10-6-3-7-11-27/h2-15,24H,16-23H2,1H3.
What are the key properties of [4-[(2,2-diphenylmorpholin-4-yl)methyl]piperidin-1-yl]-(4-methoxyphenyl)methanone?
[4-[(2,2-diphenylmorpholin-4-yl)methyl]piperidin-1-yl]-(4-methoxyphenyl)methanone has a molecular weight of 470.61 g/mol, XLogP of 4.82, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2,2-diphenylmorpholin-4-yl)methyl]piperidin-1-yl]-(4-methoxyphenyl)methanone is sourced from PubChem (CID 44529914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).