C26H22ClF3N4O2 — CID 44529966
3-[1-(2-chloro-4-methylphenyl)-6-methyl-2,3-dihydropyrrolo[2,3-b]pyridin-4-yl]-2-methyl-1,8-naphthyridine;2,2,2-trifluoroacetic acid (PubChem CID 44529966) has the molecular formula C26H22ClF3N4O2 and a molecular weight of 514.94 g/mol. Its IUPAC name is 3-[1-(2-chloro-4-methylphenyl)-6-methyl-2,3-dihydropyrrolo[2,3-b]pyridin-4-yl]-2-methyl-1,8-naphthyridine;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[1-(2-chloro-4-methylphenyl)-6-methyl-2,3-dihydropyrrolo[2,3-b]pyridin-4-yl]-2-methyl-1,8-naphthyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44529966 |
| Molecular Formula | C26H22ClF3N4O2 |
| Molecular Weight | 514.94 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 3-[1-(2-chloro-4-methylphenyl)-6-methyl-2,3-dihydropyrrolo[2,3-b]pyridin-4-yl]-2-methyl-1,8-naphthyridine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(N2CCc3c(-c4cc5cccnc5nc4C)cc(C)nc32)c(Cl)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H21ClN4.C2HF3O2/c1-14-6-7-22(21(25)11-14)29-10-8-18-20(12-15(2)27-24(18)29)19-13-17-5-4-9-26-23(17)28-16(19)3;3-2(4,5)1(6)7/h4-7,9,11-13H,8,10H2,1-3H3;(H,6,7) |
| InChIKey | BVOZLYHXCNQNDE-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 79.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.94 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|