C27H35ClF3N3O3 — CID 44530036
N-(4-chlorophenyl)-4-[(4-hexyl-1,4-diazepan-1-yl)methyl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 44530036) has the molecular formula C27H35ClF3N3O3 and a molecular weight of 542.04 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[(4-hexyl-1,4-diazepan-1-yl)methyl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(4-chlorophenyl)-4-[(4-hexyl-1,4-diazepan-1-yl)methyl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44530036 |
| Molecular Formula | C27H35ClF3N3O3 |
| Molecular Weight | 542.04 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | N-(4-chlorophenyl)-4-[(4-hexyl-1,4-diazepan-1-yl)methyl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCCN1CCCN(Cc2ccc(C(=O)Nc3ccc(Cl)cc3)cc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H34ClN3O.C2HF3O2/c1-2-3-4-5-15-28-16-6-17-29(19-18-28)20-21-7-9-22(10-8-21)25(30)27-24-13-11-23(26)12-14-24;3-2(4,5)1(6)7/h7-14H,2-6,15-20H2,1H3,(H,27,30);(H,6,7) |
| InChIKey | KFSGCJHGLDCCQF-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.04 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|