C29H40F3N3O3 — CID 44530104
N-(4-ethylphenyl)-4-[(4-hexyl-1,4-diazepan-1-yl)methyl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 44530104) has the molecular formula C29H40F3N3O3 and a molecular weight of 535.65 g/mol. Its IUPAC name is N-(4-ethylphenyl)-4-[(4-hexyl-1,4-diazepan-1-yl)methyl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(4-ethylphenyl)-4-[(4-hexyl-1,4-diazepan-1-yl)methyl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44530104 |
| Molecular Formula | C29H40F3N3O3 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.30 |
| IUPAC Name | N-(4-ethylphenyl)-4-[(4-hexyl-1,4-diazepan-1-yl)methyl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCCN1CCCN(Cc2ccc(C(=O)Nc3ccc(CC)cc3)cc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H39N3O.C2HF3O2/c1-3-5-6-7-17-29-18-8-19-30(21-20-29)22-24-9-13-25(14-10-24)27(31)28-26-15-11-23(4-2)12-16-26;3-2(4,5)1(6)7/h9-16H,3-8,17-22H2,1-2H3,(H,28,31);(H,6,7) |
| InChIKey | FPXFCAZXJGFZAF-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|