C28H28F3N3O4 — CID 44530206
2-amino-3-[4-(4-methoxyphenyl)butyl]-5,5-diphenylimidazol-4-one;2,2,2-trifluoroacetic acid (PubChem CID 44530206) has the molecular formula C28H28F3N3O4 and a molecular weight of 527.54 g/mol. Its IUPAC name is 2-amino-3-[4-(4-methoxyphenyl)butyl]-5,5-diphenylimidazol-4-one;2,2,2-trifluoroacetic acid.
| Compound Name | 2-amino-3-[4-(4-methoxyphenyl)butyl]-5,5-diphenylimidazol-4-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44530206 |
| Molecular Formula | C28H28F3N3O4 |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | 2-amino-3-[4-(4-methoxyphenyl)butyl]-5,5-diphenylimidazol-4-one;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(CCCCN2C(=O)C(c3ccccc3)(c3ccccc3)N=C2N)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H27N3O2.C2HF3O2/c1-31-23-17-15-20(16-18-23)10-8-9-19-29-24(30)26(28-25(29)27,21-11-4-2-5-12-21)22-13-6-3-7-14-22;3-2(4,5)1(6)7/h2-7,11-18H,8-10,19H2,1H3,(H2,27,28);(H,6,7) |
| InChIKey | SBOVXHNDNKQRGY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|