C19H17F3N4O — CID 44530280
2-[(2-anilinopyrimidin-4-yl)amino]-1-[3-(trifluoromethyl)phenyl]ethanol (PubChem CID 44530280) has the molecular formula C19H17F3N4O and a molecular weight of 374.37 g/mol. Its IUPAC name is 2-[(2-anilinopyrimidin-4-yl)amino]-1-[3-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 2-[(2-anilinopyrimidin-4-yl)amino]-1-[3-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 44530280 |
| Molecular Formula | C19H17F3N4O |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 2-[(2-anilinopyrimidin-4-yl)amino]-1-[3-(trifluoromethyl)phenyl]ethanol |
| SMILES | OC(CNc1ccnc(Nc2ccccc2)n1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17F3N4O/c20-19(21,22)14-6-4-5-13(11-14)16(27)12-24-17-9-10-23-18(26-17)25-15-7-2-1-3-8-15/h1-11,16,27H,12H2,(H2,23,24,25,26) |
| InChIKey | ZKCXVLUPUIIXKC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |