About 4-(2,5-dichlorophenyl)-N-(4-methoxyphenyl)-N-piperidin-4-yl-1,3-thiazol-2-amine
4-(2,5-dichlorophenyl)-N-(4-methoxyphenyl)-N-piperidin-4-yl-1,3-thiazol-2-amine (PubChem CID 44530378) has the molecular formula C21H21Cl2N3OS
and a molecular weight of 434.39 g/mol. Its IUPAC name is 4-(2,5-dichlorophenyl)-N-(4-methoxyphenyl)-N-piperidin-4-yl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-(2,5-dichlorophenyl)-N-(4-methoxyphenyl)-N-piperidin-4-yl-1,3-thiazol-2-amine |
| PubChem CID | 44530378 |
| Molecular Formula | C21H21Cl2N3OS |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 4-(2,5-dichlorophenyl)-N-(4-methoxyphenyl)-N-piperidin-4-yl-1,3-thiazol-2-amine |
| SMILES | COc1ccc(N(c2nc(-c3cc(Cl)ccc3Cl)cs2)C2CCNCC2)cc1 |
| InChI | InChI=1S/C21H21Cl2N3OS/c1-27-17-5-3-15(4-6-17)26(16-8-10-24-11-9-16)21-25-20(13-28-21)18-12-14(22)2-7-19(18)23/h2-7,12-13,16,24H,8-11H2,1H3 |
| InChIKey | WXACNUOKCQOXIN-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2,5-dichlorophenyl)-N-(4-methoxyphenyl)-N-piperidin-4-yl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dichlorophenyl)-N-(4-methoxyphenyl)-N-piperidin-4-yl-1,3-thiazol-2-amine?
The IUPAC name of 4-(2,5-dichlorophenyl)-N-(4-methoxyphenyl)-N-piperidin-4-yl-1,3-thiazol-2-amine (CID 44530378) is 4-(2,5-dichlorophenyl)-N-(4-methoxyphenyl)-N-piperidin-4-yl-1,3-thiazol-2-amine.
What is the SMILES notation for 4-(2,5-dichlorophenyl)-N-(4-methoxyphenyl)-N-piperidin-4-yl-1,3-thiazol-2-amine?
The canonical SMILES for 4-(2,5-dichlorophenyl)-N-(4-methoxyphenyl)-N-piperidin-4-yl-1,3-thiazol-2-amine is COc1ccc(N(c2nc(-c3cc(Cl)ccc3Cl)cs2)C2CCNCC2)cc1.
What is the InChIKey of 4-(2,5-dichlorophenyl)-N-(4-methoxyphenyl)-N-piperidin-4-yl-1,3-thiazol-2-amine?
The InChIKey is WXACNUOKCQOXIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21Cl2N3OS/c1-27-17-5-3-15(4-6-17)26(16-8-10-24-11-9-16)21-25-20(13-28-21)18-12-14(22)2-7-19(18)23/h2-7,12-13,16,24H,8-11H2,1H3.
What are the key properties of 4-(2,5-dichlorophenyl)-N-(4-methoxyphenyl)-N-piperidin-4-yl-1,3-thiazol-2-amine?
4-(2,5-dichlorophenyl)-N-(4-methoxyphenyl)-N-piperidin-4-yl-1,3-thiazol-2-amine has a molecular weight of 434.39 g/mol, XLogP of 6.02, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dichlorophenyl)-N-(4-methoxyphenyl)-N-piperidin-4-yl-1,3-thiazol-2-amine is sourced from PubChem (CID 44530378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).