C24H20ClN3O3S — CID 44530426
1-benzyl-5-chloro-1'-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]spiro[indole-3,3'-pyrrolidine]-2,2',5'-trione (PubChem CID 44530426) has the molecular formula C24H20ClN3O3S and a molecular weight of 465.96 g/mol. Its IUPAC name is 1-benzyl-5-chloro-1'-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]spiro[indole-3,3'-pyrrolidine]-2,2',5'-trione.
| Compound Name | 1-benzyl-5-chloro-1'-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]spiro[indole-3,3'-pyrrolidine]-2,2',5'-trione |
|---|---|
| PubChem CID | 44530426 |
| Molecular Formula | C24H20ClN3O3S |
| Molecular Weight | 465.96 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 1-benzyl-5-chloro-1'-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]spiro[indole-3,3'-pyrrolidine]-2,2',5'-trione |
| SMILES | Cc1ncsc1CCN1C(=O)CC2(C1=O)C(=O)N(Cc1ccccc1)c1ccc(Cl)cc12 |
| InChI | InChI=1S/C24H20ClN3O3S/c1-15-20(32-14-26-15)9-10-27-21(29)12-24(22(27)30)18-11-17(25)7-8-19(18)28(23(24)31)13-16-5-3-2-4-6-16/h2-8,11,14H,9-10,12-13H2,1H3 |
| InChIKey | PHYBEPLJHUOUKK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.96 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|