C28H36F3N3O4 — CID 44530490
1-N-(1-pentylpyrrolidin-3-yl)-4-N-(4-propan-2-ylphenyl)benzene-1,4-dicarboxamide;2,2,2-trifluoroacetic acid (PubChem CID 44530490) has the molecular formula C28H36F3N3O4 and a molecular weight of 535.61 g/mol. Its IUPAC name is 1-N-(1-pentylpyrrolidin-3-yl)-4-N-(4-propan-2-ylphenyl)benzene-1,4-dicarboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 1-N-(1-pentylpyrrolidin-3-yl)-4-N-(4-propan-2-ylphenyl)benzene-1,4-dicarboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44530490 |
| Molecular Formula | C28H36F3N3O4 |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | 1-N-(1-pentylpyrrolidin-3-yl)-4-N-(4-propan-2-ylphenyl)benzene-1,4-dicarboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCN1CCC(NC(=O)c2ccc(C(=O)Nc3ccc(C(C)C)cc3)cc2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H35N3O2.C2HF3O2/c1-4-5-6-16-29-17-15-24(18-29)28-26(31)22-9-7-21(8-10-22)25(30)27-23-13-11-20(12-14-23)19(2)3;3-2(4,5)1(6)7/h7-14,19,24H,4-6,15-18H2,1-3H3,(H,27,30)(H,28,31);(H,6,7) |
| InChIKey | PAFPCPJXDTYPKI-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|