C29H38F3N3O4 — CID 44530504
1-N-(1-pentylpiperidin-4-yl)-4-N-(4-propan-2-ylphenyl)benzene-1,4-dicarboxamide;2,2,2-trifluoroacetic acid (PubChem CID 44530504) has the molecular formula C29H38F3N3O4 and a molecular weight of 549.63 g/mol. Its IUPAC name is 1-N-(1-pentylpiperidin-4-yl)-4-N-(4-propan-2-ylphenyl)benzene-1,4-dicarboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 1-N-(1-pentylpiperidin-4-yl)-4-N-(4-propan-2-ylphenyl)benzene-1,4-dicarboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44530504 |
| Molecular Formula | C29H38F3N3O4 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.28 |
| IUPAC Name | 1-N-(1-pentylpiperidin-4-yl)-4-N-(4-propan-2-ylphenyl)benzene-1,4-dicarboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCN1CCC(NC(=O)c2ccc(C(=O)Nc3ccc(C(C)C)cc3)cc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H37N3O2.C2HF3O2/c1-4-5-6-17-30-18-15-25(16-19-30)29-27(32)23-9-7-22(8-10-23)26(31)28-24-13-11-21(12-14-24)20(2)3;3-2(4,5)1(6)7/h7-14,20,25H,4-6,15-19H2,1-3H3,(H,28,31)(H,29,32);(H,6,7) |
| InChIKey | GABUKUFXYMVBQJ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|