About N-[3-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]phenyl]quinoline-3-carboxamide
N-[3-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]phenyl]quinoline-3-carboxamide (PubChem CID 44530519) has the molecular formula C25H15Cl2N3O2
and a molecular weight of 460.32 g/mol. Its IUPAC name is N-[3-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]phenyl]quinoline-3-carboxamide.
Molecular Properties
| Compound Name | N-[3-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]phenyl]quinoline-3-carboxamide |
| PubChem CID | 44530519 |
| Molecular Formula | C25H15Cl2N3O2 |
| Molecular Weight | 460.32 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | N-[3-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]phenyl]quinoline-3-carboxamide |
| SMILES | O=C(Nc1cccc(-c2cc(-c3c(Cl)cccc3Cl)no2)c1)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C25H15Cl2N3O2/c26-19-8-4-9-20(27)24(19)22-13-23(32-30-22)16-6-3-7-18(12-16)29-25(31)17-11-15-5-1-2-10-21(15)28-14-17/h1-14H,(H,29,31) |
| InChIKey | MAZHKFWIUGREHC-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.32 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]phenyl]quinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]phenyl]quinoline-3-carboxamide?
The IUPAC name of N-[3-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]phenyl]quinoline-3-carboxamide (CID 44530519) is N-[3-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]phenyl]quinoline-3-carboxamide.
What is the SMILES notation for N-[3-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]phenyl]quinoline-3-carboxamide?
The canonical SMILES for N-[3-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]phenyl]quinoline-3-carboxamide is O=C(Nc1cccc(-c2cc(-c3c(Cl)cccc3Cl)no2)c1)c1cnc2ccccc2c1.
What is the InChIKey of N-[3-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]phenyl]quinoline-3-carboxamide?
The InChIKey is MAZHKFWIUGREHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H15Cl2N3O2/c26-19-8-4-9-20(27)24(19)22-13-23(32-30-22)16-6-3-7-18(12-16)29-25(31)17-11-15-5-1-2-10-21(15)28-14-17/h1-14H,(H,29,31).
What are the key properties of N-[3-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]phenyl]quinoline-3-carboxamide?
N-[3-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]phenyl]quinoline-3-carboxamide has a molecular weight of 460.32 g/mol, XLogP of 7.12, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]phenyl]quinoline-3-carboxamide is sourced from PubChem (CID 44530519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).