About 2-amino-3-cyclohexyl-5,5-diphenylimidazol-4-one
2-amino-3-cyclohexyl-5,5-diphenylimidazol-4-one (PubChem CID 44530523) has the molecular formula C21H23N3O
and a molecular weight of 333.44 g/mol. Its IUPAC name is 2-amino-3-cyclohexyl-5,5-diphenylimidazol-4-one.
Molecular Properties
| Compound Name | 2-amino-3-cyclohexyl-5,5-diphenylimidazol-4-one |
| PubChem CID | 44530523 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 2-amino-3-cyclohexyl-5,5-diphenylimidazol-4-one |
| SMILES | NC1=NC(c2ccccc2)(c2ccccc2)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C21H23N3O/c22-20-23-21(16-10-4-1-5-11-16,17-12-6-2-7-13-17)19(25)24(20)18-14-8-3-9-15-18/h1-2,4-7,10-13,18H,3,8-9,14-15H2,(H2,22,23) |
| InChIKey | LEKJIUIIENTICB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-3-cyclohexyl-5,5-diphenylimidazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-cyclohexyl-5,5-diphenylimidazol-4-one?
The IUPAC name of 2-amino-3-cyclohexyl-5,5-diphenylimidazol-4-one (CID 44530523) is 2-amino-3-cyclohexyl-5,5-diphenylimidazol-4-one.
What is the SMILES notation for 2-amino-3-cyclohexyl-5,5-diphenylimidazol-4-one?
The canonical SMILES for 2-amino-3-cyclohexyl-5,5-diphenylimidazol-4-one is NC1=NC(c2ccccc2)(c2ccccc2)C(=O)N1C1CCCCC1.
What is the InChIKey of 2-amino-3-cyclohexyl-5,5-diphenylimidazol-4-one?
The InChIKey is LEKJIUIIENTICB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O/c22-20-23-21(16-10-4-1-5-11-16,17-12-6-2-7-13-17)19(25)24(20)18-14-8-3-9-15-18/h1-2,4-7,10-13,18H,3,8-9,14-15H2,(H2,22,23).
What are the key properties of 2-amino-3-cyclohexyl-5,5-diphenylimidazol-4-one?
2-amino-3-cyclohexyl-5,5-diphenylimidazol-4-one has a molecular weight of 333.44 g/mol, XLogP of 3.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-cyclohexyl-5,5-diphenylimidazol-4-one is sourced from PubChem (CID 44530523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).