About 2-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)-N-(2-methylpropyl)acetamide
2-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)-N-(2-methylpropyl)acetamide (PubChem CID 44530795) has the molecular formula C21H24N4O2
and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)-N-(2-methylpropyl)acetamide.
Molecular Properties
| Compound Name | 2-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)-N-(2-methylpropyl)acetamide |
| PubChem CID | 44530795 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 2-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)-N-(2-methylpropyl)acetamide |
| SMILES | CC(C)CNC(=O)CN1C(=O)C(c2ccccc2)(c2ccccc2)N=C1N |
| InChI | InChI=1S/C21H24N4O2/c1-15(2)13-23-18(26)14-25-19(27)21(24-20(25)22,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,15H,13-14H2,1-2H3,(H2,22,24)(H,23,26) |
| InChIKey | TWWOAPMJPUXACL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)-N-(2-methylpropyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)-N-(2-methylpropyl)acetamide?
The IUPAC name of 2-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)-N-(2-methylpropyl)acetamide (CID 44530795) is 2-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)-N-(2-methylpropyl)acetamide.
What is the SMILES notation for 2-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)-N-(2-methylpropyl)acetamide?
The canonical SMILES for 2-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)-N-(2-methylpropyl)acetamide is CC(C)CNC(=O)CN1C(=O)C(c2ccccc2)(c2ccccc2)N=C1N.
What is the InChIKey of 2-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)-N-(2-methylpropyl)acetamide?
The InChIKey is TWWOAPMJPUXACL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N4O2/c1-15(2)13-23-18(26)14-25-19(27)21(24-20(25)22,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,15H,13-14H2,1-2H3,(H2,22,24)(H,23,26).
What are the key properties of 2-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)-N-(2-methylpropyl)acetamide?
2-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)-N-(2-methylpropyl)acetamide has a molecular weight of 364.45 g/mol, XLogP of 1.86, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)-N-(2-methylpropyl)acetamide is sourced from PubChem (CID 44530795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).