C19H19ClFN3 — CID 44530824
2-chloro-4-[(2-fluorophenyl)methyl-[(3S)-1-methylpyrrolidin-3-yl]amino]benzonitrile (PubChem CID 44530824) has the molecular formula C19H19ClFN3 and a molecular weight of 343.83 g/mol. Its IUPAC name is 2-chloro-4-[(2-fluorophenyl)methyl-[(3S)-1-methylpyrrolidin-3-yl]amino]benzonitrile.
| Compound Name | 2-chloro-4-[(2-fluorophenyl)methyl-[(3S)-1-methylpyrrolidin-3-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 44530824 |
| Molecular Formula | C19H19ClFN3 |
| Molecular Weight | 343.83 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 2-chloro-4-[(2-fluorophenyl)methyl-[(3S)-1-methylpyrrolidin-3-yl]amino]benzonitrile |
| SMILES | CN1CC[C@H](N(Cc2ccccc2F)c2ccc(C#N)c(Cl)c2)C1 |
| InChI | InChI=1S/C19H19ClFN3/c1-23-9-8-17(13-23)24(12-15-4-2-3-5-19(15)21)16-7-6-14(11-22)18(20)10-16/h2-7,10,17H,8-9,12-13H2,1H3/t17-/m0/s1 |
| InChIKey | MGTCFMFWKHWLAA-KRWDZBQOSA-N |
| XLogP | 4.06 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.83 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |