About 4-N-(4-chlorophenyl)-2-N-ethyl-2-N-(3-piperidin-1-ylpropyl)pyrimidine-2,4-diamine
4-N-(4-chlorophenyl)-2-N-ethyl-2-N-(3-piperidin-1-ylpropyl)pyrimidine-2,4-diamine (PubChem CID 44530838) has the molecular formula C20H28ClN5
and a molecular weight of 373.93 g/mol. Its IUPAC name is 4-N-(4-chlorophenyl)-2-N-ethyl-2-N-(3-piperidin-1-ylpropyl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 4-N-(4-chlorophenyl)-2-N-ethyl-2-N-(3-piperidin-1-ylpropyl)pyrimidine-2,4-diamine |
| PubChem CID | 44530838 |
| Molecular Formula | C20H28ClN5 |
| Molecular Weight | 373.93 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 4-N-(4-chlorophenyl)-2-N-ethyl-2-N-(3-piperidin-1-ylpropyl)pyrimidine-2,4-diamine |
| SMILES | CCN(CCCN1CCCCC1)c1nccc(Nc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C20H28ClN5/c1-2-26(16-6-15-25-13-4-3-5-14-25)20-22-12-11-19(24-20)23-18-9-7-17(21)8-10-18/h7-12H,2-6,13-16H2,1H3,(H,22,23,24) |
| InChIKey | BZXHTQTZQKLCJK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.93 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-N-(4-chlorophenyl)-2-N-ethyl-2-N-(3-piperidin-1-ylpropyl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(4-chlorophenyl)-2-N-ethyl-2-N-(3-piperidin-1-ylpropyl)pyrimidine-2,4-diamine?
The IUPAC name of 4-N-(4-chlorophenyl)-2-N-ethyl-2-N-(3-piperidin-1-ylpropyl)pyrimidine-2,4-diamine (CID 44530838) is 4-N-(4-chlorophenyl)-2-N-ethyl-2-N-(3-piperidin-1-ylpropyl)pyrimidine-2,4-diamine.
What is the SMILES notation for 4-N-(4-chlorophenyl)-2-N-ethyl-2-N-(3-piperidin-1-ylpropyl)pyrimidine-2,4-diamine?
The canonical SMILES for 4-N-(4-chlorophenyl)-2-N-ethyl-2-N-(3-piperidin-1-ylpropyl)pyrimidine-2,4-diamine is CCN(CCCN1CCCCC1)c1nccc(Nc2ccc(Cl)cc2)n1.
What is the InChIKey of 4-N-(4-chlorophenyl)-2-N-ethyl-2-N-(3-piperidin-1-ylpropyl)pyrimidine-2,4-diamine?
The InChIKey is BZXHTQTZQKLCJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28ClN5/c1-2-26(16-6-15-25-13-4-3-5-14-25)20-22-12-11-19(24-20)23-18-9-7-17(21)8-10-18/h7-12H,2-6,13-16H2,1H3,(H,22,23,24).
What are the key properties of 4-N-(4-chlorophenyl)-2-N-ethyl-2-N-(3-piperidin-1-ylpropyl)pyrimidine-2,4-diamine?
4-N-(4-chlorophenyl)-2-N-ethyl-2-N-(3-piperidin-1-ylpropyl)pyrimidine-2,4-diamine has a molecular weight of 373.93 g/mol, XLogP of 4.58, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(4-chlorophenyl)-2-N-ethyl-2-N-(3-piperidin-1-ylpropyl)pyrimidine-2,4-diamine is sourced from PubChem (CID 44530838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).