C29H41N5O6 — CID 44530955
benzyl N-[(5S)-5-[[(2R,3S)-3-[formyl(hydroxy)amino]-2-(2-methylpropyl)pentanoyl]amino]-6-oxo-6-(pyridin-2-ylamino)hexyl]carbamate (PubChem CID 44530955) has the molecular formula C29H41N5O6 and a molecular weight of 555.68 g/mol. Its IUPAC name is benzyl N-[(5S)-5-[[(2R,3S)-3-[formyl(hydroxy)amino]-2-(2-methylpropyl)pentanoyl]amino]-6-oxo-6-(pyridin-2-ylamino)hexyl]carbamate.
| Compound Name | benzyl N-[(5S)-5-[[(2R,3S)-3-[formyl(hydroxy)amino]-2-(2-methylpropyl)pentanoyl]amino]-6-oxo-6-(pyridin-2-ylamino)hexyl]carbamate |
|---|---|
| PubChem CID | 44530955 |
| Molecular Formula | C29H41N5O6 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.31 |
| IUPAC Name | benzyl N-[(5S)-5-[[(2R,3S)-3-[formyl(hydroxy)amino]-2-(2-methylpropyl)pentanoyl]amino]-6-oxo-6-(pyridin-2-ylamino)hexyl]carbamate |
| SMILES | CC[C@@H]([C@@H](CC(C)C)C(=O)N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)Nc1ccccn1)N(O)C=O |
| InChI | InChI=1S/C29H41N5O6/c1-4-25(34(39)20-35)23(18-21(2)3)27(36)32-24(28(37)33-26-15-9-11-16-30-26)14-8-10-17-31-29(38)40-19-22-12-6-5-7-13-22/h5-7,9,11-13,15-16,20-21,23-25,39H,4,8,10,14,17-19H2,1-3H3,(H,31,38)(H,32,36)(H,30,33,37)/t23-,24+,25+/m1/s1 |
| InChIKey | FPHCNWPDLAXZGD-DSITVLBTSA-N |
| XLogP | 3.89 |
| TPSA | 149.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|