C42H52N2O4 — CID 44530997
1,4-bis[4-[2-(diethylamino)ethoxy]phenyl]-1,4-bis(4-methylphenyl)but-2-yne-1,4-diol (PubChem CID 44530997) has the molecular formula C42H52N2O4 and a molecular weight of 648.89 g/mol. Its IUPAC name is 1,4-bis[4-[2-(diethylamino)ethoxy]phenyl]-1,4-bis(4-methylphenyl)but-2-yne-1,4-diol.
| Compound Name | 1,4-bis[4-[2-(diethylamino)ethoxy]phenyl]-1,4-bis(4-methylphenyl)but-2-yne-1,4-diol |
|---|---|
| PubChem CID | 44530997 |
| Molecular Formula | C42H52N2O4 |
| Molecular Weight | 648.89 g/mol |
| Exact Mass | 648.39 |
| IUPAC Name | 1,4-bis[4-[2-(diethylamino)ethoxy]phenyl]-1,4-bis(4-methylphenyl)but-2-yne-1,4-diol |
| SMILES | CCN(CC)CCOc1ccc(C(O)(C#CC(O)(c2ccc(C)cc2)c2ccc(OCCN(CC)CC)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C42H52N2O4/c1-7-43(8-2)29-31-47-39-23-19-37(20-24-39)41(45,35-15-11-33(5)12-16-35)27-28-42(46,36-17-13-34(6)14-18-36)38-21-25-40(26-22-38)48-32-30-44(9-3)10-4/h11-26,45-46H,7-10,29-32H2,1-6H3 |
| InChIKey | YTWFKYRWNBZZAU-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.89 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|