C21H25ClN6O — CID 44531003
1,3-bis[3-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]urea;hydrochloride (PubChem CID 44531003) has the molecular formula C21H25ClN6O and a molecular weight of 412.93 g/mol. Its IUPAC name is 1,3-bis[3-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]urea;hydrochloride.
| Compound Name | 1,3-bis[3-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]urea;hydrochloride |
|---|---|
| PubChem CID | 44531003 |
| Molecular Formula | C21H25ClN6O |
| Molecular Weight | 412.93 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 1,3-bis[3-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]urea;hydrochloride |
| SMILES | Cl.O=C(Nc1cccc(C2=NCCCN2)c1)Nc1cccc(C2=NCCCN2)c1 |
| InChI | InChI=1S/C21H24N6O.ClH/c28-21(26-17-7-1-5-15(13-17)19-22-9-3-10-23-19)27-18-8-2-6-16(14-18)20-24-11-4-12-25-20;/h1-2,5-8,13-14H,3-4,9-12H2,(H,22,23)(H,24,25)(H2,26,27,28);1H |
| InChIKey | XFIJXMXRNZMJCD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.93 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |