About 5-(3,4-dibromophenyl)-6-methylpyrimidine-2,4-diamine
5-(3,4-dibromophenyl)-6-methylpyrimidine-2,4-diamine (PubChem CID 44531192) has the molecular formula C11H10Br2N4
and a molecular weight of 358.04 g/mol. Its IUPAC name is 5-(3,4-dibromophenyl)-6-methylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-(3,4-dibromophenyl)-6-methylpyrimidine-2,4-diamine |
| PubChem CID | 44531192 |
| Molecular Formula | C11H10Br2N4 |
| Molecular Weight | 358.04 g/mol |
| Exact Mass | 355.93 |
| IUPAC Name | 5-(3,4-dibromophenyl)-6-methylpyrimidine-2,4-diamine |
| SMILES | Cc1nc(N)nc(N)c1-c1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C11H10Br2N4/c1-5-9(10(14)17-11(15)16-5)6-2-3-7(12)8(13)4-6/h2-4H,1H3,(H4,14,15,16,17) |
| InChIKey | UBDASFHSDVPGQV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.04 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3,4-dibromophenyl)-6-methylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dibromophenyl)-6-methylpyrimidine-2,4-diamine?
The IUPAC name of 5-(3,4-dibromophenyl)-6-methylpyrimidine-2,4-diamine (CID 44531192) is 5-(3,4-dibromophenyl)-6-methylpyrimidine-2,4-diamine.
What is the SMILES notation for 5-(3,4-dibromophenyl)-6-methylpyrimidine-2,4-diamine?
The canonical SMILES for 5-(3,4-dibromophenyl)-6-methylpyrimidine-2,4-diamine is Cc1nc(N)nc(N)c1-c1ccc(Br)c(Br)c1.
What is the InChIKey of 5-(3,4-dibromophenyl)-6-methylpyrimidine-2,4-diamine?
The InChIKey is UBDASFHSDVPGQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Br2N4/c1-5-9(10(14)17-11(15)16-5)6-2-3-7(12)8(13)4-6/h2-4H,1H3,(H4,14,15,16,17).
What are the key properties of 5-(3,4-dibromophenyl)-6-methylpyrimidine-2,4-diamine?
5-(3,4-dibromophenyl)-6-methylpyrimidine-2,4-diamine has a molecular weight of 358.04 g/mol, XLogP of 3.14, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dibromophenyl)-6-methylpyrimidine-2,4-diamine is sourced from PubChem (CID 44531192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).