C20H30O3 — CID 44531198
(4aR,4bR,10bS,12aR)-2,2,4a,10b-tetramethyl-4,4b,5,6,6a,7,8,11,12,12a-decahydrophenanthro[2,1-d][1,3]dioxin-9-one (PubChem CID 44531198) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (4aR,4bR,10bS,12aR)-2,2,4a,10b-tetramethyl-4,4b,5,6,6a,7,8,11,12,12a-decahydrophenanthro[2,1-d][1,3]dioxin-9-one.
| Compound Name | (4aR,4bR,10bS,12aR)-2,2,4a,10b-tetramethyl-4,4b,5,6,6a,7,8,11,12,12a-decahydrophenanthro[2,1-d][1,3]dioxin-9-one |
|---|---|
| PubChem CID | 44531198 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (4aR,4bR,10bS,12aR)-2,2,4a,10b-tetramethyl-4,4b,5,6,6a,7,8,11,12,12a-decahydrophenanthro[2,1-d][1,3]dioxin-9-one |
| SMILES | CC1(C)OC[C@]2(C)[C@@H](CC[C@]3(C)C4=CC(=O)CCC4CC[C@@H]23)O1 |
| InChI | InChI=1S/C20H30O3/c1-18(2)22-12-20(4)16-8-6-13-5-7-14(21)11-15(13)19(16,3)10-9-17(20)23-18/h11,13,16-17H,5-10,12H2,1-4H3/t13?,16-,17-,19-,20+/m1/s1 |
| InChIKey | AEBSRBKPBWAWPM-WNDJGVFBSA-N |
| XLogP | 4.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |