C17H22BrNO — CID 44531233
1-[(1E,3E)-penta-1,3-dienyl]-6-propoxy-3,4-dihydroisoquinoline;hydrobromide (PubChem CID 44531233) has the molecular formula C17H22BrNO and a molecular weight of 336.27 g/mol. Its IUPAC name is 1-[(1E,3E)-penta-1,3-dienyl]-6-propoxy-3,4-dihydroisoquinoline;hydrobromide.
| Compound Name | 1-[(1E,3E)-penta-1,3-dienyl]-6-propoxy-3,4-dihydroisoquinoline;hydrobromide |
|---|---|
| PubChem CID | 44531233 |
| Molecular Formula | C17H22BrNO |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 1-[(1E,3E)-penta-1,3-dienyl]-6-propoxy-3,4-dihydroisoquinoline;hydrobromide |
| SMILES | Br.C/C=C/C=C/C1=NCCc2cc(OCCC)ccc21 |
| InChI | InChI=1S/C17H21NO.BrH/c1-3-5-6-7-17-16-9-8-15(19-12-4-2)13-14(16)10-11-18-17;/h3,5-9,13H,4,10-12H2,1-2H3;1H/b5-3+,7-6+; |
| InChIKey | ZNRJFBICJDASOJ-WJXKTOMQSA-N |
| XLogP | 4.53 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|