About 1-(diaminomethylidene)-3-(3,4,5-trichlorophenyl)urea
1-(diaminomethylidene)-3-(3,4,5-trichlorophenyl)urea (PubChem CID 44531269) has the molecular formula C8H7Cl3N4O
and a molecular weight of 281.53 g/mol. Its IUPAC name is 1-(diaminomethylidene)-3-(3,4,5-trichlorophenyl)urea.
Molecular Properties
| Compound Name | 1-(diaminomethylidene)-3-(3,4,5-trichlorophenyl)urea |
| PubChem CID | 44531269 |
| Molecular Formula | C8H7Cl3N4O |
| Molecular Weight | 281.53 g/mol |
| Exact Mass | 279.97 |
| IUPAC Name | 1-(diaminomethylidene)-3-(3,4,5-trichlorophenyl)urea |
| SMILES | NC(N)=NC(=O)Nc1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H7Cl3N4O/c9-4-1-3(2-5(10)6(4)11)14-8(16)15-7(12)13/h1-2H,(H5,12,13,14,15,16) |
| InChIKey | MZLQWOOSWDRPRK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.53 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(diaminomethylidene)-3-(3,4,5-trichlorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(diaminomethylidene)-3-(3,4,5-trichlorophenyl)urea?
The IUPAC name of 1-(diaminomethylidene)-3-(3,4,5-trichlorophenyl)urea (CID 44531269) is 1-(diaminomethylidene)-3-(3,4,5-trichlorophenyl)urea.
What is the SMILES notation for 1-(diaminomethylidene)-3-(3,4,5-trichlorophenyl)urea?
The canonical SMILES for 1-(diaminomethylidene)-3-(3,4,5-trichlorophenyl)urea is NC(N)=NC(=O)Nc1cc(Cl)c(Cl)c(Cl)c1.
What is the InChIKey of 1-(diaminomethylidene)-3-(3,4,5-trichlorophenyl)urea?
The InChIKey is MZLQWOOSWDRPRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Cl3N4O/c9-4-1-3(2-5(10)6(4)11)14-8(16)15-7(12)13/h1-2H,(H5,12,13,14,15,16).
What are the key properties of 1-(diaminomethylidene)-3-(3,4,5-trichlorophenyl)urea?
1-(diaminomethylidene)-3-(3,4,5-trichlorophenyl)urea has a molecular weight of 281.53 g/mol, XLogP of 2.45, 1 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(diaminomethylidene)-3-(3,4,5-trichlorophenyl)urea is sourced from PubChem (CID 44531269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).