C17H14Cl2N4 — CID 44531315
4,6-bis[(4-chlorophenyl)methyl]-1,3,5-triazin-2-amine (PubChem CID 44531315) has the molecular formula C17H14Cl2N4 and a molecular weight of 345.23 g/mol. Its IUPAC name is 4,6-bis[(4-chlorophenyl)methyl]-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis[(4-chlorophenyl)methyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 44531315 |
| Molecular Formula | C17H14Cl2N4 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 4,6-bis[(4-chlorophenyl)methyl]-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(Cc2ccc(Cl)cc2)nc(Cc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C17H14Cl2N4/c18-13-5-1-11(2-6-13)9-15-21-16(23-17(20)22-15)10-12-3-7-14(19)8-4-12/h1-8H,9-10H2,(H2,20,21,22,23) |
| InChIKey | PLQFQWTWZUMTMM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |