C22H35ClN2O2 — CID 44531436
1,5-bis[(pentan-3-ylamino)methyl]naphthalene-2,6-diol;hydrochloride (PubChem CID 44531436) has the molecular formula C22H35ClN2O2 and a molecular weight of 394.99 g/mol. Its IUPAC name is 1,5-bis[(pentan-3-ylamino)methyl]naphthalene-2,6-diol;hydrochloride.
| Compound Name | 1,5-bis[(pentan-3-ylamino)methyl]naphthalene-2,6-diol;hydrochloride |
|---|---|
| PubChem CID | 44531436 |
| Molecular Formula | C22H35ClN2O2 |
| Molecular Weight | 394.99 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 1,5-bis[(pentan-3-ylamino)methyl]naphthalene-2,6-diol;hydrochloride |
| SMILES | CCC(CC)NCc1c(O)ccc2c(CNC(CC)CC)c(O)ccc12.Cl |
| InChI | InChI=1S/C22H34N2O2.ClH/c1-5-15(6-2)23-13-19-17-9-12-22(26)20(14-24-16(7-3)8-4)18(17)10-11-21(19)25;/h9-12,15-16,23-26H,5-8,13-14H2,1-4H3;1H |
| InChIKey | HPFFKAKLTCEZJA-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.99 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|