About 1,5-bis(propylaminomethyl)naphthalene-2,6-diol;hydrochloride
1,5-bis(propylaminomethyl)naphthalene-2,6-diol;hydrochloride (PubChem CID 44531458) has the molecular formula C18H27ClN2O2
and a molecular weight of 338.88 g/mol. Its IUPAC name is 1,5-bis(propylaminomethyl)naphthalene-2,6-diol;hydrochloride.
Molecular Properties
| Compound Name | 1,5-bis(propylaminomethyl)naphthalene-2,6-diol;hydrochloride |
| PubChem CID | 44531458 |
| Molecular Formula | C18H27ClN2O2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 1,5-bis(propylaminomethyl)naphthalene-2,6-diol;hydrochloride |
| SMILES | CCCNCc1c(O)ccc2c(CNCCC)c(O)ccc12.Cl |
| InChI | InChI=1S/C18H26N2O2.ClH/c1-3-9-19-11-15-13-5-8-18(22)16(12-20-10-4-2)14(13)6-7-17(15)21;/h5-8,19-22H,3-4,9-12H2,1-2H3;1H |
| InChIKey | GYRJMMDHIXWSPV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,5-bis(propylaminomethyl)naphthalene-2,6-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-bis(propylaminomethyl)naphthalene-2,6-diol;hydrochloride?
The IUPAC name of 1,5-bis(propylaminomethyl)naphthalene-2,6-diol;hydrochloride (CID 44531458) is 1,5-bis(propylaminomethyl)naphthalene-2,6-diol;hydrochloride.
What is the SMILES notation for 1,5-bis(propylaminomethyl)naphthalene-2,6-diol;hydrochloride?
The canonical SMILES for 1,5-bis(propylaminomethyl)naphthalene-2,6-diol;hydrochloride is CCCNCc1c(O)ccc2c(CNCCC)c(O)ccc12.Cl.
What is the InChIKey of 1,5-bis(propylaminomethyl)naphthalene-2,6-diol;hydrochloride?
The InChIKey is GYRJMMDHIXWSPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O2.ClH/c1-3-9-19-11-15-13-5-8-18(22)16(12-20-10-4-2)14(13)6-7-17(15)21;/h5-8,19-22H,3-4,9-12H2,1-2H3;1H.
What are the key properties of 1,5-bis(propylaminomethyl)naphthalene-2,6-diol;hydrochloride?
1,5-bis(propylaminomethyl)naphthalene-2,6-diol;hydrochloride has a molecular weight of 338.88 g/mol, XLogP of 3.67, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-bis(propylaminomethyl)naphthalene-2,6-diol;hydrochloride is sourced from PubChem (CID 44531458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).