C15H13ClFN5 — CID 44531587
7-chloro-6-[(4-fluorophenyl)methyl]-5-methylpyrido[2,3-d]pyrimidine-2,4-diamine (PubChem CID 44531587) has the molecular formula C15H13ClFN5 and a molecular weight of 317.76 g/mol. Its IUPAC name is 7-chloro-6-[(4-fluorophenyl)methyl]-5-methylpyrido[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 7-chloro-6-[(4-fluorophenyl)methyl]-5-methylpyrido[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 44531587 |
| Molecular Formula | C15H13ClFN5 |
| Molecular Weight | 317.76 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 7-chloro-6-[(4-fluorophenyl)methyl]-5-methylpyrido[2,3-d]pyrimidine-2,4-diamine |
| SMILES | Cc1c(Cc2ccc(F)cc2)c(Cl)nc2nc(N)nc(N)c12 |
| InChI | InChI=1S/C15H13ClFN5/c1-7-10(6-8-2-4-9(17)5-3-8)12(16)20-14-11(7)13(18)21-15(19)22-14/h2-5H,6H2,1H3,(H4,18,19,20,21,22) |
| InChIKey | ADNJGLIGNPIOOE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.76 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|