About N-[2-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenoxy]ethyl]hexan-1-amine
N-[2-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenoxy]ethyl]hexan-1-amine (PubChem CID 44531591) has the molecular formula C29H33N3O
and a molecular weight of 439.60 g/mol. Its IUPAC name is N-[2-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenoxy]ethyl]hexan-1-amine.
Molecular Properties
| Compound Name | N-[2-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenoxy]ethyl]hexan-1-amine |
| PubChem CID | 44531591 |
| Molecular Formula | C29H33N3O |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | N-[2-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenoxy]ethyl]hexan-1-amine |
| SMILES | CCCCCCNCCOc1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C29H33N3O/c1-2-3-4-11-20-30-21-22-33-26-18-16-25(17-19-26)29-31-27(23-12-7-5-8-13-23)28(32-29)24-14-9-6-10-15-24/h5-10,12-19,30H,2-4,11,20-22H2,1H3,(H,31,32) |
| InChIKey | AATWGPBYLKOXRS-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenoxy]ethyl]hexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenoxy]ethyl]hexan-1-amine?
The IUPAC name of N-[2-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenoxy]ethyl]hexan-1-amine (CID 44531591) is N-[2-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenoxy]ethyl]hexan-1-amine.
What is the SMILES notation for N-[2-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenoxy]ethyl]hexan-1-amine?
The canonical SMILES for N-[2-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenoxy]ethyl]hexan-1-amine is CCCCCCNCCOc1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1.
What is the InChIKey of N-[2-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenoxy]ethyl]hexan-1-amine?
The InChIKey is AATWGPBYLKOXRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H33N3O/c1-2-3-4-11-20-30-21-22-33-26-18-16-25(17-19-26)29-31-27(23-12-7-5-8-13-23)28(32-29)24-14-9-6-10-15-24/h5-10,12-19,30H,2-4,11,20-22H2,1H3,(H,31,32).
What are the key properties of N-[2-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenoxy]ethyl]hexan-1-amine?
N-[2-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenoxy]ethyl]hexan-1-amine has a molecular weight of 439.60 g/mol, XLogP of 6.96, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenoxy]ethyl]hexan-1-amine is sourced from PubChem (CID 44531591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).