C16H26ClN5 — CID 44531615
6,6-dimethyl-1-(4-pentylphenyl)-1,3,5-triazine-2,4-diamine;hydrochloride (PubChem CID 44531615) has the molecular formula C16H26ClN5 and a molecular weight of 323.87 g/mol. Its IUPAC name is 6,6-dimethyl-1-(4-pentylphenyl)-1,3,5-triazine-2,4-diamine;hydrochloride.
| Compound Name | 6,6-dimethyl-1-(4-pentylphenyl)-1,3,5-triazine-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 44531615 |
| Molecular Formula | C16H26ClN5 |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 6,6-dimethyl-1-(4-pentylphenyl)-1,3,5-triazine-2,4-diamine;hydrochloride |
| SMILES | CCCCCc1ccc(N2C(N)=NC(N)=NC2(C)C)cc1.Cl |
| InChI | InChI=1S/C16H25N5.ClH/c1-4-5-6-7-12-8-10-13(11-9-12)21-15(18)19-14(17)20-16(21,2)3;/h8-11H,4-7H2,1-3H3,(H4,17,18,19,20);1H |
| InChIKey | IDLJXXSMHZEEIC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|