C29H38N2O7S — CID 44531664
2-[[12-[[(1,3-dihydroxy-2-methylpropan-2-yl)amino]methyl]chrysen-6-yl]methylamino]-2-methylpropane-1,3-diol;methanesulfonic acid (PubChem CID 44531664) has the molecular formula C29H38N2O7S and a molecular weight of 558.70 g/mol. Its IUPAC name is 2-[[12-[[(1,3-dihydroxy-2-methylpropan-2-yl)amino]methyl]chrysen-6-yl]methylamino]-2-methylpropane-1,3-diol;methanesulfonic acid.
| Compound Name | 2-[[12-[[(1,3-dihydroxy-2-methylpropan-2-yl)amino]methyl]chrysen-6-yl]methylamino]-2-methylpropane-1,3-diol;methanesulfonic acid |
|---|---|
| PubChem CID | 44531664 |
| Molecular Formula | C29H38N2O7S |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | 2-[[12-[[(1,3-dihydroxy-2-methylpropan-2-yl)amino]methyl]chrysen-6-yl]methylamino]-2-methylpropane-1,3-diol;methanesulfonic acid |
| SMILES | CC(CO)(CO)NCc1cc2c3ccccc3c(CNC(C)(CO)CO)cc2c2ccccc12.CS(=O)(=O)O |
| InChI | InChI=1S/C28H34N2O4.CH4O3S/c1-27(15-31,16-32)29-13-19-11-25-24-10-6-4-8-22(24)20(14-30-28(2,17-33)18-34)12-26(25)23-9-5-3-7-21(19)23;1-5(2,3)4/h3-12,29-34H,13-18H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | QNRUVKZCSIZUDH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 159.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|