C28H34N2O4 — CID 44531665
2-[[12-[[(1,3-dihydroxy-2-methylpropan-2-yl)amino]methyl]chrysen-6-yl]methylamino]-2-methylpropane-1,3-diol (PubChem CID 44531665) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is 2-[[12-[[(1,3-dihydroxy-2-methylpropan-2-yl)amino]methyl]chrysen-6-yl]methylamino]-2-methylpropane-1,3-diol.
| Compound Name | 2-[[12-[[(1,3-dihydroxy-2-methylpropan-2-yl)amino]methyl]chrysen-6-yl]methylamino]-2-methylpropane-1,3-diol |
|---|---|
| PubChem CID | 44531665 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 2-[[12-[[(1,3-dihydroxy-2-methylpropan-2-yl)amino]methyl]chrysen-6-yl]methylamino]-2-methylpropane-1,3-diol |
| SMILES | CC(CO)(CO)NCc1cc2c3ccccc3c(CNC(C)(CO)CO)cc2c2ccccc12 |
| InChI | InChI=1S/C28H34N2O4/c1-27(15-31,16-32)29-13-19-11-25-24-10-6-4-8-22(24)20(14-30-28(2,17-33)18-34)12-26(25)23-9-5-3-7-21(19)23/h3-12,29-34H,13-18H2,1-2H3 |
| InChIKey | JBCZHYAAZWROSK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|