C22H25NO5S2 — CID 44531666
methanesulfonic acid;2-methyl-2-(naphtho[2,1-g][1]benzothiol-7-ylmethylamino)propane-1,3-diol (PubChem CID 44531666) has the molecular formula C22H25NO5S2 and a molecular weight of 447.58 g/mol. Its IUPAC name is methanesulfonic acid;2-methyl-2-(naphtho[2,1-g][1]benzothiol-7-ylmethylamino)propane-1,3-diol.
| Compound Name | methanesulfonic acid;2-methyl-2-(naphtho[2,1-g][1]benzothiol-7-ylmethylamino)propane-1,3-diol |
|---|---|
| PubChem CID | 44531666 |
| Molecular Formula | C22H25NO5S2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | methanesulfonic acid;2-methyl-2-(naphtho[2,1-g][1]benzothiol-7-ylmethylamino)propane-1,3-diol |
| SMILES | CC(CO)(CO)NCc1cc2ccc3ccsc3c2c2ccccc12.CS(=O)(=O)O |
| InChI | InChI=1S/C21H21NO2S.CH4O3S/c1-21(12-23,13-24)22-11-16-10-15-7-6-14-8-9-25-20(14)19(15)18-5-3-2-4-17(16)18;1-5(2,3)4/h2-10,22-24H,11-13H2,1H3;1H3,(H,2,3,4) |
| InChIKey | IJOUOKRFCOUIIS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|