C31H40N2O3S3 — CID 44531677
N,N'-bis[2-(2-methylsulfanylnaphthalen-1-yl)ethyl]butane-1,4-diamine;methanesulfonic acid (PubChem CID 44531677) has the molecular formula C31H40N2O3S3 and a molecular weight of 584.87 g/mol. Its IUPAC name is N,N'-bis[2-(2-methylsulfanylnaphthalen-1-yl)ethyl]butane-1,4-diamine;methanesulfonic acid.
| Compound Name | N,N'-bis[2-(2-methylsulfanylnaphthalen-1-yl)ethyl]butane-1,4-diamine;methanesulfonic acid |
|---|---|
| PubChem CID | 44531677 |
| Molecular Formula | C31H40N2O3S3 |
| Molecular Weight | 584.87 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | N,N'-bis[2-(2-methylsulfanylnaphthalen-1-yl)ethyl]butane-1,4-diamine;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.CSc1ccc2ccccc2c1CCNCCCCNCCc1c(SC)ccc2ccccc12 |
| InChI | InChI=1S/C30H36N2S2.CH4O3S/c1-33-29-15-13-23-9-3-5-11-25(23)27(29)17-21-31-19-7-8-20-32-22-18-28-26-12-6-4-10-24(26)14-16-30(28)34-2;1-5(2,3)4/h3-6,9-16,31-32H,7-8,17-22H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | AREMJBFZAIBNQU-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.87 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|