C18H15N5O2 — CID 44531722
7-(1,3-benzodioxol-5-ylmethyl)pyrrolo[3,2-f]quinazoline-1,3-diamine (PubChem CID 44531722) has the molecular formula C18H15N5O2 and a molecular weight of 333.35 g/mol. Its IUPAC name is 7-(1,3-benzodioxol-5-ylmethyl)pyrrolo[3,2-f]quinazoline-1,3-diamine.
| Compound Name | 7-(1,3-benzodioxol-5-ylmethyl)pyrrolo[3,2-f]quinazoline-1,3-diamine |
|---|---|
| PubChem CID | 44531722 |
| Molecular Formula | C18H15N5O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 7-(1,3-benzodioxol-5-ylmethyl)pyrrolo[3,2-f]quinazoline-1,3-diamine |
| SMILES | Nc1nc(N)c2c(ccc3c2ccn3Cc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C18H15N5O2/c19-17-16-11-5-6-23(13(11)3-2-12(16)21-18(20)22-17)8-10-1-4-14-15(7-10)25-9-24-14/h1-7H,8-9H2,(H4,19,20,21,22) |
| InChIKey | QDGPJDFXLIQWGU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |