About 3-propan-2-ylpyrazolo[4,5-f]quinazoline-7,9-diamine
3-propan-2-ylpyrazolo[4,5-f]quinazoline-7,9-diamine (PubChem CID 44531794) has the molecular formula C12H14N6
and a molecular weight of 242.29 g/mol. Its IUPAC name is 3-propan-2-ylpyrazolo[4,5-f]quinazoline-7,9-diamine.
Molecular Properties
| Compound Name | 3-propan-2-ylpyrazolo[4,5-f]quinazoline-7,9-diamine |
| PubChem CID | 44531794 |
| Molecular Formula | C12H14N6 |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 3-propan-2-ylpyrazolo[4,5-f]quinazoline-7,9-diamine |
| SMILES | CC(C)n1ncc2c3c(N)nc(N)nc3ccc21 |
| InChI | InChI=1S/C12H14N6/c1-6(2)18-9-4-3-8-10(7(9)5-15-18)11(13)17-12(14)16-8/h3-6H,1-2H3,(H4,13,14,16,17) |
| InChIKey | QZSKDMIHANKNJX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-propan-2-ylpyrazolo[4,5-f]quinazoline-7,9-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-ylpyrazolo[4,5-f]quinazoline-7,9-diamine?
The IUPAC name of 3-propan-2-ylpyrazolo[4,5-f]quinazoline-7,9-diamine (CID 44531794) is 3-propan-2-ylpyrazolo[4,5-f]quinazoline-7,9-diamine.
What is the SMILES notation for 3-propan-2-ylpyrazolo[4,5-f]quinazoline-7,9-diamine?
The canonical SMILES for 3-propan-2-ylpyrazolo[4,5-f]quinazoline-7,9-diamine is CC(C)n1ncc2c3c(N)nc(N)nc3ccc21.
What is the InChIKey of 3-propan-2-ylpyrazolo[4,5-f]quinazoline-7,9-diamine?
The InChIKey is QZSKDMIHANKNJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N6/c1-6(2)18-9-4-3-8-10(7(9)5-15-18)11(13)17-12(14)16-8/h3-6H,1-2H3,(H4,13,14,16,17).
What are the key properties of 3-propan-2-ylpyrazolo[4,5-f]quinazoline-7,9-diamine?
3-propan-2-ylpyrazolo[4,5-f]quinazoline-7,9-diamine has a molecular weight of 242.29 g/mol, XLogP of 1.72, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-ylpyrazolo[4,5-f]quinazoline-7,9-diamine is sourced from PubChem (CID 44531794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).