About N,N'-bis(8-methoxyquinolin-4-yl)ethane-1,2-diamine
N,N'-bis(8-methoxyquinolin-4-yl)ethane-1,2-diamine (PubChem CID 44531812) has the molecular formula C22H22N4O2
and a molecular weight of 374.44 g/mol. Its IUPAC name is N,N'-bis(8-methoxyquinolin-4-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N,N'-bis(8-methoxyquinolin-4-yl)ethane-1,2-diamine |
| PubChem CID | 44531812 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | N,N'-bis(8-methoxyquinolin-4-yl)ethane-1,2-diamine |
| SMILES | COc1cccc2c(NCCNc3ccnc4c(OC)cccc34)ccnc12 |
| InChI | InChI=1S/C22H22N4O2/c1-27-19-7-3-5-15-17(9-11-25-21(15)19)23-13-14-24-18-10-12-26-22-16(18)6-4-8-20(22)28-2/h3-12H,13-14H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | OBEXOFONJDJASX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(8-methoxyquinolin-4-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(8-methoxyquinolin-4-yl)ethane-1,2-diamine?
The IUPAC name of N,N'-bis(8-methoxyquinolin-4-yl)ethane-1,2-diamine (CID 44531812) is N,N'-bis(8-methoxyquinolin-4-yl)ethane-1,2-diamine.
What is the SMILES notation for N,N'-bis(8-methoxyquinolin-4-yl)ethane-1,2-diamine?
The canonical SMILES for N,N'-bis(8-methoxyquinolin-4-yl)ethane-1,2-diamine is COc1cccc2c(NCCNc3ccnc4c(OC)cccc34)ccnc12.
What is the InChIKey of N,N'-bis(8-methoxyquinolin-4-yl)ethane-1,2-diamine?
The InChIKey is OBEXOFONJDJASX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N4O2/c1-27-19-7-3-5-15-17(9-11-25-21(15)19)23-13-14-24-18-10-12-26-22-16(18)6-4-8-20(22)28-2/h3-12H,13-14H2,1-2H3,(H,23,25)(H,24,26).
What are the key properties of N,N'-bis(8-methoxyquinolin-4-yl)ethane-1,2-diamine?
N,N'-bis(8-methoxyquinolin-4-yl)ethane-1,2-diamine has a molecular weight of 374.44 g/mol, XLogP of 4.32, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(8-methoxyquinolin-4-yl)ethane-1,2-diamine is sourced from PubChem (CID 44531812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).