C35H48N2O5S — CID 44531905
N,N'-bis[2-(1-propoxynaphthalen-2-yl)ethyl]butane-1,4-diamine;methanesulfonic acid (PubChem CID 44531905) has the molecular formula C35H48N2O5S and a molecular weight of 608.85 g/mol. Its IUPAC name is N,N'-bis[2-(1-propoxynaphthalen-2-yl)ethyl]butane-1,4-diamine;methanesulfonic acid.
| Compound Name | N,N'-bis[2-(1-propoxynaphthalen-2-yl)ethyl]butane-1,4-diamine;methanesulfonic acid |
|---|---|
| PubChem CID | 44531905 |
| Molecular Formula | C35H48N2O5S |
| Molecular Weight | 608.85 g/mol |
| Exact Mass | 608.33 |
| IUPAC Name | N,N'-bis[2-(1-propoxynaphthalen-2-yl)ethyl]butane-1,4-diamine;methanesulfonic acid |
| SMILES | CCCOc1c(CCNCCCCNCCc2ccc3ccccc3c2OCCC)ccc2ccccc12.CS(=O)(=O)O |
| InChI | InChI=1S/C34H44N2O2.CH4O3S/c1-3-25-37-33-29(17-15-27-11-5-7-13-31(27)33)19-23-35-21-9-10-22-36-24-20-30-18-16-28-12-6-8-14-32(28)34(30)38-26-4-2;1-5(2,3)4/h5-8,11-18,35-36H,3-4,9-10,19-26H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | NPVCKYNGNLWWLY-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.85 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|