C37H52N2O5S — CID 44531943
N,N'-bis[(1-butoxynaphthalen-2-yl)methyl]hexane-1,6-diamine;methanesulfonic acid (PubChem CID 44531943) has the molecular formula C37H52N2O5S and a molecular weight of 636.90 g/mol. Its IUPAC name is N,N'-bis[(1-butoxynaphthalen-2-yl)methyl]hexane-1,6-diamine;methanesulfonic acid.
| Compound Name | N,N'-bis[(1-butoxynaphthalen-2-yl)methyl]hexane-1,6-diamine;methanesulfonic acid |
|---|---|
| PubChem CID | 44531943 |
| Molecular Formula | C37H52N2O5S |
| Molecular Weight | 636.90 g/mol |
| Exact Mass | 636.36 |
| IUPAC Name | N,N'-bis[(1-butoxynaphthalen-2-yl)methyl]hexane-1,6-diamine;methanesulfonic acid |
| SMILES | CCCCOc1c(CNCCCCCCNCc2ccc3ccccc3c2OCCCC)ccc2ccccc12.CS(=O)(=O)O |
| InChI | InChI=1S/C36H48N2O2.CH4O3S/c1-3-5-25-39-35-31(21-19-29-15-9-11-17-33(29)35)27-37-23-13-7-8-14-24-38-28-32-22-20-30-16-10-12-18-34(30)36(32)40-26-6-4-2;1-5(2,3)4/h9-12,15-22,37-38H,3-8,13-14,23-28H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | BBKXVAWBAKRGCH-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.90 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|