C27H41ClN6 — CID 44532037
6-benzyl-2-N,4-N,7-N-tributyl-5-methylpyrido[2,3-d]pyrimidine-2,4,7-triamine;hydrochloride (PubChem CID 44532037) has the molecular formula C27H41ClN6 and a molecular weight of 485.12 g/mol. Its IUPAC name is 6-benzyl-2-N,4-N,7-N-tributyl-5-methylpyrido[2,3-d]pyrimidine-2,4,7-triamine;hydrochloride.
| Compound Name | 6-benzyl-2-N,4-N,7-N-tributyl-5-methylpyrido[2,3-d]pyrimidine-2,4,7-triamine;hydrochloride |
|---|---|
| PubChem CID | 44532037 |
| Molecular Formula | C27H41ClN6 |
| Molecular Weight | 485.12 g/mol |
| Exact Mass | 484.31 |
| IUPAC Name | 6-benzyl-2-N,4-N,7-N-tributyl-5-methylpyrido[2,3-d]pyrimidine-2,4,7-triamine;hydrochloride |
| SMILES | CCCCNc1nc(NCCCC)c2c(C)c(Cc3ccccc3)c(NCCCC)nc2n1.Cl |
| InChI | InChI=1S/C27H40N6.ClH/c1-5-8-16-28-24-22(19-21-14-12-11-13-15-21)20(4)23-25(29-17-9-6-2)32-27(30-18-10-7-3)33-26(23)31-24;/h11-15H,5-10,16-19H2,1-4H3,(H3,28,29,30,31,32,33);1H |
| InChIKey | CJCJFSCBOPGCMS-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.12 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|