C36H39N9O6 — CID 44532061
(2R,3R,4S,5S)-2-[6-(2,2-diphenylethylamino)-2-[2-(pyridin-2-ylamino)ethylamino]purin-9-yl]-5-(3-ethyl-1,2-oxazol-5-yl)oxolane-3,4-diol;formic acid (PubChem CID 44532061) has the molecular formula C36H39N9O6 and a molecular weight of 693.77 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[6-(2,2-diphenylethylamino)-2-[2-(pyridin-2-ylamino)ethylamino]purin-9-yl]-5-(3-ethyl-1,2-oxazol-5-yl)oxolane-3,4-diol;formic acid.
| Compound Name | (2R,3R,4S,5S)-2-[6-(2,2-diphenylethylamino)-2-[2-(pyridin-2-ylamino)ethylamino]purin-9-yl]-5-(3-ethyl-1,2-oxazol-5-yl)oxolane-3,4-diol;formic acid |
|---|---|
| PubChem CID | 44532061 |
| Molecular Formula | C36H39N9O6 |
| Molecular Weight | 693.77 g/mol |
| Exact Mass | 693.30 |
| IUPAC Name | (2R,3R,4S,5S)-2-[6-(2,2-diphenylethylamino)-2-[2-(pyridin-2-ylamino)ethylamino]purin-9-yl]-5-(3-ethyl-1,2-oxazol-5-yl)oxolane-3,4-diol;formic acid |
| SMILES | CCc1cc([C@H]2O[C@@H](n3cnc4c(NCC(c5ccccc5)c5ccccc5)nc(NCCNc5ccccn5)nc43)[C@H](O)[C@@H]2O)on1.O=CO |
| InChI | InChI=1S/C35H37N9O4.CH2O2/c1-2-24-19-26(48-43-24)31-29(45)30(46)34(47-31)44-21-40-28-32(39-20-25(22-11-5-3-6-12-22)23-13-7-4-8-14-23)41-35(42-33(28)44)38-18-17-37-27-15-9-10-16-36-27;2-1-3/h3-16,19,21,25,29-31,34,45-46H,2,17-18,20H2,1H3,(H,36,37)(H2,38,39,41,42);1H,(H,2,3)/t29-,30+,31+,34+;/m0./s1 |
| InChIKey | BAZRQDSNJXTJTP-KQTLVNGBSA-N |
| XLogP | 4.23 |
| TPSA | 205.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.77 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|