C19H21BrClN3 — CID 44532068
6-[[2-(2-bromophenyl)ethylamino]methyl]-4-methylquinolin-2-amine;hydrochloride (PubChem CID 44532068) has the molecular formula C19H21BrClN3 and a molecular weight of 406.76 g/mol. Its IUPAC name is 6-[[2-(2-bromophenyl)ethylamino]methyl]-4-methylquinolin-2-amine;hydrochloride.
| Compound Name | 6-[[2-(2-bromophenyl)ethylamino]methyl]-4-methylquinolin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 44532068 |
| Molecular Formula | C19H21BrClN3 |
| Molecular Weight | 406.76 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 6-[[2-(2-bromophenyl)ethylamino]methyl]-4-methylquinolin-2-amine;hydrochloride |
| SMILES | Cc1cc(N)nc2ccc(CNCCc3ccccc3Br)cc12.Cl |
| InChI | InChI=1S/C19H20BrN3.ClH/c1-13-10-19(21)23-18-7-6-14(11-16(13)18)12-22-9-8-15-4-2-3-5-17(15)20;/h2-7,10-11,22H,8-9,12H2,1H3,(H2,21,23);1H |
| InChIKey | UKUQZYSYPORBEI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.76 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|