C24H41N5O6S2 — CID 44532132
(2R,3S)-2-(cyclohexylmethyl)-3-[formyl(hydroxy)amino]-N-[(2S)-6-(methanesulfonamido)-1-oxo-1-(1,3-thiazol-2-ylamino)hexan-2-yl]hexanamide (PubChem CID 44532132) has the molecular formula C24H41N5O6S2 and a molecular weight of 559.76 g/mol. Its IUPAC name is (2R,3S)-2-(cyclohexylmethyl)-3-[formyl(hydroxy)amino]-N-[(2S)-6-(methanesulfonamido)-1-oxo-1-(1,3-thiazol-2-ylamino)hexan-2-yl]hexanamide.
| Compound Name | (2R,3S)-2-(cyclohexylmethyl)-3-[formyl(hydroxy)amino]-N-[(2S)-6-(methanesulfonamido)-1-oxo-1-(1,3-thiazol-2-ylamino)hexan-2-yl]hexanamide |
|---|---|
| PubChem CID | 44532132 |
| Molecular Formula | C24H41N5O6S2 |
| Molecular Weight | 559.76 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | (2R,3S)-2-(cyclohexylmethyl)-3-[formyl(hydroxy)amino]-N-[(2S)-6-(methanesulfonamido)-1-oxo-1-(1,3-thiazol-2-ylamino)hexan-2-yl]hexanamide |
| SMILES | CCC[C@@H]([C@@H](CC1CCCCC1)C(=O)N[C@@H](CCCCNS(C)(=O)=O)C(=O)Nc1nccs1)N(O)C=O |
| InChI | InChI=1S/C24H41N5O6S2/c1-3-9-21(29(33)17-30)19(16-18-10-5-4-6-11-18)22(31)27-20(12-7-8-13-26-37(2,34)35)23(32)28-24-25-14-15-36-24/h14-15,17-21,26,33H,3-13,16H2,1-2H3,(H,27,31)(H,25,28,32)/t19-,20+,21+/m1/s1 |
| InChIKey | BHFFRPGXBLMVNT-HKBOAZHASA-N |
| XLogP | 2.89 |
| TPSA | 157.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.76 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|