About 1-phenyl-2-[4-[(7-pyridin-2-ylquinolin-4-yl)amino]phenyl]ethane-1,2-dione;hydrochloride
1-phenyl-2-[4-[(7-pyridin-2-ylquinolin-4-yl)amino]phenyl]ethane-1,2-dione;hydrochloride (PubChem CID 44532208) has the molecular formula C28H20ClN3O2
and a molecular weight of 465.94 g/mol. Its IUPAC name is 1-phenyl-2-[4-[(7-pyridin-2-ylquinolin-4-yl)amino]phenyl]ethane-1,2-dione;hydrochloride.
Molecular Properties
| Compound Name | 1-phenyl-2-[4-[(7-pyridin-2-ylquinolin-4-yl)amino]phenyl]ethane-1,2-dione;hydrochloride |
| PubChem CID | 44532208 |
| Molecular Formula | C28H20ClN3O2 |
| Molecular Weight | 465.94 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 1-phenyl-2-[4-[(7-pyridin-2-ylquinolin-4-yl)amino]phenyl]ethane-1,2-dione;hydrochloride |
| SMILES | Cl.O=C(C(=O)c1ccc(Nc2ccnc3cc(-c4ccccn4)ccc23)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H19N3O2.ClH/c32-27(19-6-2-1-3-7-19)28(33)20-9-12-22(13-10-20)31-25-15-17-30-26-18-21(11-14-23(25)26)24-8-4-5-16-29-24;/h1-18H,(H,30,31);1H |
| InChIKey | XVHUDFMXZBJUMO-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.94 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-2-[4-[(7-pyridin-2-ylquinolin-4-yl)amino]phenyl]ethane-1,2-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-2-[4-[(7-pyridin-2-ylquinolin-4-yl)amino]phenyl]ethane-1,2-dione;hydrochloride?
The IUPAC name of 1-phenyl-2-[4-[(7-pyridin-2-ylquinolin-4-yl)amino]phenyl]ethane-1,2-dione;hydrochloride (CID 44532208) is 1-phenyl-2-[4-[(7-pyridin-2-ylquinolin-4-yl)amino]phenyl]ethane-1,2-dione;hydrochloride.
What is the SMILES notation for 1-phenyl-2-[4-[(7-pyridin-2-ylquinolin-4-yl)amino]phenyl]ethane-1,2-dione;hydrochloride?
The canonical SMILES for 1-phenyl-2-[4-[(7-pyridin-2-ylquinolin-4-yl)amino]phenyl]ethane-1,2-dione;hydrochloride is Cl.O=C(C(=O)c1ccc(Nc2ccnc3cc(-c4ccccn4)ccc23)cc1)c1ccccc1.
What is the InChIKey of 1-phenyl-2-[4-[(7-pyridin-2-ylquinolin-4-yl)amino]phenyl]ethane-1,2-dione;hydrochloride?
The InChIKey is XVHUDFMXZBJUMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H19N3O2.ClH/c32-27(19-6-2-1-3-7-19)28(33)20-9-12-22(13-10-20)31-25-15-17-30-26-18-21(11-14-23(25)26)24-8-4-5-16-29-24;/h1-18H,(H,30,31);1H.
What are the key properties of 1-phenyl-2-[4-[(7-pyridin-2-ylquinolin-4-yl)amino]phenyl]ethane-1,2-dione;hydrochloride?
1-phenyl-2-[4-[(7-pyridin-2-ylquinolin-4-yl)amino]phenyl]ethane-1,2-dione;hydrochloride has a molecular weight of 465.94 g/mol, XLogP of 6.53, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-2-[4-[(7-pyridin-2-ylquinolin-4-yl)amino]phenyl]ethane-1,2-dione;hydrochloride is sourced from PubChem (CID 44532208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).