About N-(3,4-dimethoxyphenyl)-7-pyridin-2-ylquinolin-4-amine;hydrochloride
N-(3,4-dimethoxyphenyl)-7-pyridin-2-ylquinolin-4-amine;hydrochloride (PubChem CID 44532214) has the molecular formula C22H20ClN3O2
and a molecular weight of 393.87 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-7-pyridin-2-ylquinolin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | N-(3,4-dimethoxyphenyl)-7-pyridin-2-ylquinolin-4-amine;hydrochloride |
| PubChem CID | 44532214 |
| Molecular Formula | C22H20ClN3O2 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-7-pyridin-2-ylquinolin-4-amine;hydrochloride |
| SMILES | COc1ccc(Nc2ccnc3cc(-c4ccccn4)ccc23)cc1OC.Cl |
| InChI | InChI=1S/C22H19N3O2.ClH/c1-26-21-9-7-16(14-22(21)27-2)25-19-10-12-24-20-13-15(6-8-17(19)20)18-5-3-4-11-23-18;/h3-14H,1-2H3,(H,24,25);1H |
| InChIKey | DSGJKSVGVCUQKS-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3,4-dimethoxyphenyl)-7-pyridin-2-ylquinolin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dimethoxyphenyl)-7-pyridin-2-ylquinolin-4-amine;hydrochloride?
The IUPAC name of N-(3,4-dimethoxyphenyl)-7-pyridin-2-ylquinolin-4-amine;hydrochloride (CID 44532214) is N-(3,4-dimethoxyphenyl)-7-pyridin-2-ylquinolin-4-amine;hydrochloride.
What is the SMILES notation for N-(3,4-dimethoxyphenyl)-7-pyridin-2-ylquinolin-4-amine;hydrochloride?
The canonical SMILES for N-(3,4-dimethoxyphenyl)-7-pyridin-2-ylquinolin-4-amine;hydrochloride is COc1ccc(Nc2ccnc3cc(-c4ccccn4)ccc23)cc1OC.Cl.
What is the InChIKey of N-(3,4-dimethoxyphenyl)-7-pyridin-2-ylquinolin-4-amine;hydrochloride?
The InChIKey is DSGJKSVGVCUQKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3O2.ClH/c1-26-21-9-7-16(14-22(21)27-2)25-19-10-12-24-20-13-15(6-8-17(19)20)18-5-3-4-11-23-18;/h3-14H,1-2H3,(H,24,25);1H.
What are the key properties of N-(3,4-dimethoxyphenyl)-7-pyridin-2-ylquinolin-4-amine;hydrochloride?
N-(3,4-dimethoxyphenyl)-7-pyridin-2-ylquinolin-4-amine;hydrochloride has a molecular weight of 393.87 g/mol, XLogP of 5.48, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dimethoxyphenyl)-7-pyridin-2-ylquinolin-4-amine;hydrochloride is sourced from PubChem (CID 44532214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).