C32H34F6N4O4 — CID 44532232
N-[4-[4-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]butylcarbamoyl]phenyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 44532232) has the molecular formula C32H34F6N4O4 and a molecular weight of 652.64 g/mol. Its IUPAC name is N-[4-[4-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]butylcarbamoyl]phenyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[4-[4-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]butylcarbamoyl]phenyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 44532232 |
| Molecular Formula | C32H34F6N4O4 |
| Molecular Weight | 652.64 g/mol |
| Exact Mass | 652.25 |
| IUPAC Name | N-[4-[4-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]butylcarbamoyl]phenyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | COc1ccc(N2CCN(CCCCNC(=O)c3ccc(NC(=O)c4cc(C(F)(F)F)cc(C(F)(F)F)c4)cc3)CC2)cc1OC |
| InChI | InChI=1S/C32H34F6N4O4/c1-45-27-10-9-26(20-28(27)46-2)42-15-13-41(14-16-42)12-4-3-11-39-29(43)21-5-7-25(8-6-21)40-30(44)22-17-23(31(33,34)35)19-24(18-22)32(36,37)38/h5-10,17-20H,3-4,11-16H2,1-2H3,(H,39,43)(H,40,44) |
| InChIKey | CFUDXLJMKGBESI-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.64 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|